C23H45F3O5SSi2 — CID 101421819
[(3S,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethylcyclohexen-1-yl] trifluoromethanesulfonate (PubChem CID 101421819) has the molecular formula C23H45F3O5SSi2 and a molecular weight of 546.84 g/mol. Its IUPAC name is [(3S,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethylcyclohexen-1-yl] trifluoromethanesulfonate.
| Compound Name | [(3S,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethylcyclohexen-1-yl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 101421819 |
| Molecular Formula | C23H45F3O5SSi2 |
| Molecular Weight | 546.84 g/mol |
| Exact Mass | 546.25 |
| IUPAC Name | [(3S,4R,5R,6R)-4,5-bis[[tert-butyl(dimethyl)silyl]oxymethyl]-3,6-dimethylcyclohexen-1-yl] trifluoromethanesulfonate |
| SMILES | CC1C=C(OS(=O)(=O)C(F)(F)F)[C@H](C)[C@H](CO[Si](C)(C)C(C)(C)C)[C@@H]1CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C23H45F3O5SSi2/c1-16-13-20(31-32(27,28)23(24,25)26)17(2)19(15-30-34(11,12)22(6,7)8)18(16)14-29-33(9,10)21(3,4)5/h13,16-19H,14-15H2,1-12H3/t16?,17-,18-,19+/m1/s1 |
| InChIKey | IBMNPCWRRBOGHP-MSRNWOCLSA-N |
| XLogP | 7.30 |
| TPSA | 61.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 34 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.84 |
| LogP ≤ 5 | 7.30 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|