C24H27F3O4SSi — CID 87838764
[(1R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-bicyclo[3.1.0]hex-2-enyl] trifluoromethanesulfonate (PubChem CID 87838764) has the molecular formula C24H27F3O4SSi and a molecular weight of 496.62 g/mol. Its IUPAC name is [(1R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-bicyclo[3.1.0]hex-2-enyl] trifluoromethanesulfonate.
| Compound Name | [(1R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-bicyclo[3.1.0]hex-2-enyl] trifluoromethanesulfonate |
|---|---|
| PubChem CID | 87838764 |
| Molecular Formula | C24H27F3O4SSi |
| Molecular Weight | 496.62 g/mol |
| Exact Mass | 496.14 |
| IUPAC Name | [(1R,5S,6R)-6-[[tert-butyl(diphenyl)silyl]oxymethyl]-3-bicyclo[3.1.0]hex-2-enyl] trifluoromethanesulfonate |
| SMILES | CC(C)(C)[Si](OC[C@H]1[C@@H]2C=C(OS(=O)(=O)C(F)(F)F)C[C@@H]21)(c1ccccc1)c1ccccc1 |
| InChI | InChI=1S/C24H27F3O4SSi/c1-23(2,3)33(18-10-6-4-7-11-18,19-12-8-5-9-13-19)30-16-22-20-14-17(15-21(20)22)31-32(28,29)24(25,26)27/h4-14,20-22H,15-16H2,1-3H3/t20-,21+,22+/m1/s1 |
| InChIKey | LAXRFFLELYQWPX-FSSWDIPSSA-N |
| XLogP | 4.58 |
| TPSA | 52.60 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 496.62 |
| LogP ≤ 5 | 4.58 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'}, {'alert_name': 'triflate', 'substructure': 'N/A'} |
|---|