C24H33NO3Si — CID 53254447
(2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-methylidenebutanoyl)-2-[(E)-2-phenylethenyl]-2,3-dihydropyridin-4-one (PubChem CID 53254447) has the molecular formula C24H33NO3Si and a molecular weight of 411.62 g/mol. Its IUPAC name is (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-methylidenebutanoyl)-2-[(E)-2-phenylethenyl]-2,3-dihydropyridin-4-one.
| Compound Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-methylidenebutanoyl)-2-[(E)-2-phenylethenyl]-2,3-dihydropyridin-4-one |
|---|---|
| PubChem CID | 53254447 |
| Molecular Formula | C24H33NO3Si |
| Molecular Weight | 411.62 g/mol |
| Exact Mass | 411.22 |
| IUPAC Name | (2R,3S)-3-[tert-butyl(dimethyl)silyl]oxy-1-(2-methylidenebutanoyl)-2-[(E)-2-phenylethenyl]-2,3-dihydropyridin-4-one |
| SMILES | C=C(CC)C(=O)N1C=CC(=O)[C@@H](O[Si](C)(C)C(C)(C)C)[C@H]1/C=C/c1ccccc1 |
| InChI | InChI=1S/C24H33NO3Si/c1-8-18(2)23(27)25-17-16-21(26)22(28-29(6,7)24(3,4)5)20(25)15-14-19-12-10-9-11-13-19/h9-17,20,22H,2,8H2,1,3-7H3/b15-14+/t20-,22+/m1/s1 |
| InChIKey | PIOROOOCDFVASG-HBXUSSAYSA-N |
| XLogP | 5.35 |
| TPSA | 46.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 411.62 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Michael_acceptor_1', 'substructure': 'N/A'} |
|---|