C17H23NO9 — CID 44583544
(2S,4S,5R,6R)-5-benzamido-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 44583544) has the molecular formula C17H23NO9 and a molecular weight of 385.37 g/mol. Its IUPAC name is (2S,4S,5R,6R)-5-benzamido-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2S,4S,5R,6R)-5-benzamido-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 44583544 |
| Molecular Formula | C17H23NO9 |
| Molecular Weight | 385.37 g/mol |
| Exact Mass | 385.14 |
| IUPAC Name | (2S,4S,5R,6R)-5-benzamido-4-hydroxy-2-methoxy-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | CO[C@@]1(C(=O)O)C[C@H](O)[C@@H](NC(=O)c2ccccc2)[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C17H23NO9/c1-26-17(16(24)25)7-10(20)12(14(27-17)13(22)11(21)8-19)18-15(23)9-5-3-2-4-6-9/h2-6,10-14,19-22H,7-8H2,1H3,(H,18,23)(H,24,25)/t10-,11+,12+,13+,14+,17-/m0/s1 |
| InChIKey | LYUOFMADPSVYQI-UJNKEFAKSA-N |
| XLogP | -1.92 |
| TPSA | 165.78 Ų |
| H-Bond Donors | 6 |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 385.37 |
| LogP ≤ 5 | -1.92 |
| H-Bond Donors ≤ 5 | 6 |
| H-Bond Acceptors ≤ 10 | 8 |