C18H32N2O13 — CID 90124691
(2R,4R,5R)-4-hydroxy-2-methoxy-5-[[2-[2-(2-methoxyethoxy)ethoxycarbonylamino]acetyl]amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid (PubChem CID 90124691) has the molecular formula C18H32N2O13 and a molecular weight of 484.46 g/mol. Its IUPAC name is (2R,4R,5R)-4-hydroxy-2-methoxy-5-[[2-[2-(2-methoxyethoxy)ethoxycarbonylamino]acetyl]amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid.
| Compound Name | (2R,4R,5R)-4-hydroxy-2-methoxy-5-[[2-[2-(2-methoxyethoxy)ethoxycarbonylamino]acetyl]amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
|---|---|
| PubChem CID | 90124691 |
| Molecular Formula | C18H32N2O13 |
| Molecular Weight | 484.46 g/mol |
| Exact Mass | 484.19 |
| IUPAC Name | (2R,4R,5R)-4-hydroxy-2-methoxy-5-[[2-[2-(2-methoxyethoxy)ethoxycarbonylamino]acetyl]amino]-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylic acid |
| SMILES | COCCOCCOC(=O)NCC(=O)N[C@H]1C([C@H](O)[C@H](O)CO)O[C@@](OC)(C(=O)O)C[C@H]1O |
| InChI | InChI=1S/C18H32N2O13/c1-29-3-4-31-5-6-32-17(28)19-8-12(24)20-13-10(22)7-18(30-2,16(26)27)33-15(13)14(25)11(23)9-21/h10-11,13-15,21-23,25H,3-9H2,1-2H3,(H,19,28)(H,20,24)(H,26,27)/t10-,11-,13-,14-,15?,18-/m1/s1 |
| InChIKey | FXLJTWDUQILXNN-XQHWYJGDSA-N |
| XLogP | -3.85 |
| TPSA | 222.57 Ų |
| H-Bond Donors | 7 |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 33 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 484.46 |
| LogP ≤ 5 | -3.85 |
| H-Bond Donors ≤ 5 | 7 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|