C12H20FO6- — CID 158911536
3-fluoro-2,4,5-trimethyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 158911536) has the molecular formula C12H20FO6- and a molecular weight of 279.28 g/mol. Its IUPAC name is 3-fluoro-2,4,5-trimethyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | 3-fluoro-2,4,5-trimethyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 158911536 |
| Molecular Formula | C12H20FO6- |
| Molecular Weight | 279.28 g/mol |
| Exact Mass | 279.12 |
| IUPAC Name | 3-fluoro-2,4,5-trimethyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | CC1C(C)C(F)C(C)(C(=O)[O-])OC1[C@H](O)[C@H](O)CO |
| InChI | InChI=1S/C12H21FO6/c1-5-6(2)10(13)12(3,11(17)18)19-9(5)8(16)7(15)4-14/h5-10,14-16H,4H2,1-3H3,(H,17,18)/p-1/t5?,6?,7-,8-,9?,10?,12?/m1/s1 |
| InChIKey | JGSDNPAODNZXIZ-WJUJJDMWSA-M |
| XLogP | -1.78 |
| TPSA | 110.05 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 279.28 |
| LogP ≤ 5 | -1.78 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |