C13H23NO8S — CID 23242146
(2S,4S,5R,6R)-4-acetyloxy-5-azaniumyl-2-ethylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate (PubChem CID 23242146) has the molecular formula C13H23NO8S and a molecular weight of 353.39 g/mol. Its IUPAC name is (2S,4S,5R,6R)-4-acetyloxy-5-azaniumyl-2-ethylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate.
| Compound Name | (2S,4S,5R,6R)-4-acetyloxy-5-azaniumyl-2-ethylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
|---|---|
| PubChem CID | 23242146 |
| Molecular Formula | C13H23NO8S |
| Molecular Weight | 353.39 g/mol |
| Exact Mass | 353.11 |
| IUPAC Name | (2S,4S,5R,6R)-4-acetyloxy-5-azaniumyl-2-ethylsulfanyl-6-[(1R,2R)-1,2,3-trihydroxypropyl]oxane-2-carboxylate |
| SMILES | CCS[C@]1(C(=O)[O-])C[C@H](OC(C)=O)[C@@H]([NH3+])[C@H]([C@H](O)[C@H](O)CO)O1 |
| InChI | InChI=1S/C13H23NO8S/c1-3-23-13(12(19)20)4-8(21-6(2)16)9(14)11(22-13)10(18)7(17)5-15/h7-11,15,17-18H,3-5,14H2,1-2H3,(H,19,20)/t7-,8+,9-,10-,11-,13+/m1/s1 |
| InChIKey | HCQFTNBPZLOBEU-XAGGSGLKSA-N |
| XLogP | -3.77 |
| TPSA | 163.99 Ų |
| H-Bond Donors | 4 |
| H-Bond Acceptors | 9 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.39 |
| LogP ≤ 5 | -3.77 |
| H-Bond Donors ≤ 5 | 4 |
| H-Bond Acceptors ≤ 10 | 9 |