C12H19F2N3O5 — CID 158259932
1-[(3R,4S,6R)-4-azido-5,6-difluoro-6-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]propan-2-one (PubChem CID 158259932) has the molecular formula C12H19F2N3O5 and a molecular weight of 323.30 g/mol. Its IUPAC name is 1-[(3R,4S,6R)-4-azido-5,6-difluoro-6-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]propan-2-one.
| Compound Name | 1-[(3R,4S,6R)-4-azido-5,6-difluoro-6-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]propan-2-one |
|---|---|
| PubChem CID | 158259932 |
| Molecular Formula | C12H19F2N3O5 |
| Molecular Weight | 323.30 g/mol |
| Exact Mass | 323.13 |
| IUPAC Name | 1-[(3R,4S,6R)-4-azido-5,6-difluoro-6-methyl-2-[(1R,2R)-1,2,3-trihydroxypropyl]oxan-3-yl]propan-2-one |
| SMILES | CC(=O)C[C@H]1C([C@H](O)[C@H](O)CO)O[C@](C)(F)C(F)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C12H19F2N3O5/c1-5(19)3-6-8(16-17-15)11(13)12(2,14)22-10(6)9(21)7(20)4-18/h6-11,18,20-21H,3-4H2,1-2H3/t6-,7-,8+,9-,10?,11?,12+/m1/s1 |
| InChIKey | CNQGMDOVZBQITM-IUDAXFNGSA-N |
| XLogP | 0.40 |
| TPSA | 135.75 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 323.30 |
| LogP ≤ 5 | 0.40 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|