C9H15N3O5S — CID 53375307
[(1S,2S,6R)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl] methanesulfonate (PubChem CID 53375307) has the molecular formula C9H15N3O5S and a molecular weight of 277.30 g/mol. Its IUPAC name is [(1S,2S,6R)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl] methanesulfonate.
| Compound Name | [(1S,2S,6R)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl] methanesulfonate |
|---|---|
| PubChem CID | 53375307 |
| Molecular Formula | C9H15N3O5S |
| Molecular Weight | 277.30 g/mol |
| Exact Mass | 277.07 |
| IUPAC Name | [(1S,2S,6R)-6-azido-2-(methoxymethoxy)cyclohex-3-en-1-yl] methanesulfonate |
| SMILES | COCO[C@H]1C=CC[C@@H](N=[N+]=[N-])[C@@H]1OS(C)(=O)=O |
| InChI | InChI=1S/C9H15N3O5S/c1-15-6-16-8-5-3-4-7(11-12-10)9(8)17-18(2,13)14/h3,5,7-9H,4,6H2,1-2H3/t7-,8+,9+/m1/s1 |
| InChIKey | KMFDFBHDBDVSLE-VGMNWLOBSA-N |
| XLogP | 0.96 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.30 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|