C21H26N4O3S — CID 175902456
[(1R,2S,6R)-2-azido-6-(dibenzylamino)cyclohexyl] methanesulfonate (PubChem CID 175902456) has the molecular formula C21H26N4O3S and a molecular weight of 414.53 g/mol. Its IUPAC name is [(1R,2S,6R)-2-azido-6-(dibenzylamino)cyclohexyl] methanesulfonate.
| Compound Name | [(1R,2S,6R)-2-azido-6-(dibenzylamino)cyclohexyl] methanesulfonate |
|---|---|
| PubChem CID | 175902456 |
| Molecular Formula | C21H26N4O3S |
| Molecular Weight | 414.53 g/mol |
| Exact Mass | 414.17 |
| IUPAC Name | [(1R,2S,6R)-2-azido-6-(dibenzylamino)cyclohexyl] methanesulfonate |
| SMILES | CS(=O)(=O)O[C@H]1[C@@H](N=[N+]=[N-])CCC[C@H]1N(Cc1ccccc1)Cc1ccccc1 |
| InChI | InChI=1S/C21H26N4O3S/c1-29(26,27)28-21-19(23-24-22)13-8-14-20(21)25(15-17-9-4-2-5-10-17)16-18-11-6-3-7-12-18/h2-7,9-12,19-21H,8,13-16H2,1H3/t19-,20+,21-/m0/s1 |
| InChIKey | IWLNCEFITWJNPH-HBMCJLEFSA-N |
| XLogP | 4.26 |
| TPSA | 95.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 414.53 |
| LogP ≤ 5 | 4.26 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_1', 'substructure': 'N/A'} |
|---|