C27H36N4O4 — CID 102469806
(4S,5S)-4-[[(4S,5R)-5-azido-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-N,N-dibenzyl-2,2-dimethyl-1,3-dioxan-5-amine (PubChem CID 102469806) has the molecular formula C27H36N4O4 and a molecular weight of 480.61 g/mol. Its IUPAC name is (4S,5S)-4-[[(4S,5R)-5-azido-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-N,N-dibenzyl-2,2-dimethyl-1,3-dioxan-5-amine.
| Compound Name | (4S,5S)-4-[[(4S,5R)-5-azido-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-N,N-dibenzyl-2,2-dimethyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 102469806 |
| Molecular Formula | C27H36N4O4 |
| Molecular Weight | 480.61 g/mol |
| Exact Mass | 480.27 |
| IUPAC Name | (4S,5S)-4-[[(4S,5R)-5-azido-2,2-dimethyl-1,3-dioxan-4-yl]methyl]-N,N-dibenzyl-2,2-dimethyl-1,3-dioxan-5-amine |
| SMILES | CC1(C)OC[C@@H](N=[N+]=[N-])[C@H](C[C@@H]2OC(C)(C)OC[C@@H]2N(Cc2ccccc2)Cc2ccccc2)O1 |
| InChI | InChI=1S/C27H36N4O4/c1-26(2)32-18-22(29-30-28)24(34-26)15-25-23(19-33-27(3,4)35-25)31(16-20-11-7-5-8-12-20)17-21-13-9-6-10-14-21/h5-14,22-25H,15-19H2,1-4H3/t22-,23+,24+,25+/m1/s1 |
| InChIKey | KYIUJORQAFFOBT-ROHNOIKCSA-N |
| XLogP | 5.43 |
| TPSA | 88.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 35 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.61 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|