C24H31NO2 — CID 11210772
(4S,5S)-N-benzyl-2,2-dimethyl-N-(3-methylbut-2-enyl)-4-phenyl-1,3-dioxan-5-amine (PubChem CID 11210772) has the molecular formula C24H31NO2 and a molecular weight of 365.52 g/mol. Its IUPAC name is (4S,5S)-N-benzyl-2,2-dimethyl-N-(3-methylbut-2-enyl)-4-phenyl-1,3-dioxan-5-amine.
| Compound Name | (4S,5S)-N-benzyl-2,2-dimethyl-N-(3-methylbut-2-enyl)-4-phenyl-1,3-dioxan-5-amine |
|---|---|
| PubChem CID | 11210772 |
| Molecular Formula | C24H31NO2 |
| Molecular Weight | 365.52 g/mol |
| Exact Mass | 365.24 |
| IUPAC Name | (4S,5S)-N-benzyl-2,2-dimethyl-N-(3-methylbut-2-enyl)-4-phenyl-1,3-dioxan-5-amine |
| SMILES | CC(C)=CCN(Cc1ccccc1)[C@H]1COC(C)(C)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C24H31NO2/c1-19(2)15-16-25(17-20-11-7-5-8-12-20)22-18-26-24(3,4)27-23(22)21-13-9-6-10-14-21/h5-15,22-23H,16-18H2,1-4H3/t22-,23-/m0/s1 |
| InChIKey | GBVDJTGINQEMND-GOTSBHOMSA-N |
| XLogP | 5.35 |
| TPSA | 21.70 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 365.52 |
| LogP ≤ 5 | 5.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|