C33H39N3O7 — CID 102222078
(2R,3R,4S,5S,6S)-2-(azidomethyl)-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 102222078) has the molecular formula C33H39N3O7 and a molecular weight of 589.69 g/mol. Its IUPAC name is (2R,3R,4S,5S,6S)-2-(azidomethyl)-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2R,3R,4S,5S,6S)-2-(azidomethyl)-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 102222078 |
| Molecular Formula | C33H39N3O7 |
| Molecular Weight | 589.69 g/mol |
| Exact Mass | 589.28 |
| IUPAC Name | (2R,3R,4S,5S,6S)-2-(azidomethyl)-6-[(2,2-dimethyl-1,3-dioxolan-4-yl)methoxy]-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | CC1(C)OCC(CO[C@H]2O[C@H](CN=[N+]=[N-])[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C33H39N3O7/c1-33(2)41-23-27(43-33)22-40-32-31(39-21-26-16-10-5-11-17-26)30(38-20-25-14-8-4-9-15-25)29(28(42-32)18-35-36-34)37-19-24-12-6-3-7-13-24/h3-17,27-32H,18-23H2,1-2H3/t27?,28-,29-,30+,31+,32+/m1/s1 |
| InChIKey | XNFYGLLTOFAEAN-JUVDDNKMSA-N |
| XLogP | 5.95 |
| TPSA | 113.37 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 8 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 43 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 589.69 |
| LogP ≤ 5 | 5.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 8 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|