C34H42O7 — CID 11226789
(2S,3S,4R,5R,6R)-2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol (PubChem CID 11226789) has the molecular formula C34H42O7 and a molecular weight of 562.70 g/mol. Its IUPAC name is (2S,3S,4R,5R,6R)-2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol.
| Compound Name | (2S,3S,4R,5R,6R)-2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
|---|---|
| PubChem CID | 11226789 |
| Molecular Formula | C34H42O7 |
| Molecular Weight | 562.70 g/mol |
| Exact Mass | 562.29 |
| IUPAC Name | (2S,3S,4R,5R,6R)-2-[2-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]ethyl]-4,5-bis(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-3-ol |
| SMILES | CC1(C)OC[C@@H](CC[C@@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2O)O1 |
| InChI | InChI=1S/C34H42O7/c1-34(2)39-23-28(41-34)18-19-29-31(35)33(38-22-27-16-10-5-11-17-27)32(37-21-26-14-8-4-9-15-26)30(40-29)24-36-20-25-12-6-3-7-13-25/h3-17,28-33,35H,18-24H2,1-2H3/t28-,29+,30-,31+,32-,33-/m1/s1 |
| InChIKey | ARSRFUQKZOQGPD-LVRYTLHTSA-N |
| XLogP | 5.43 |
| TPSA | 75.61 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 41 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 562.70 |
| LogP ≤ 5 | 5.43 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |