C43H50O10 — CID 11061583
(3S,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butan-2-one (PubChem CID 11061583) has the molecular formula C43H50O10 and a molecular weight of 726.86 g/mol. Its IUPAC name is (3S,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butan-2-one.
| Compound Name | (3S,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butan-2-one |
|---|---|
| PubChem CID | 11061583 |
| Molecular Formula | C43H50O10 |
| Molecular Weight | 726.86 g/mol |
| Exact Mass | 726.34 |
| IUPAC Name | (3S,4S)-4-[(4R)-2,2-dimethyl-1,3-dioxolan-4-yl]-3,4-dihydroxy-1-[(2R,3S,4R,5R,6R)-3,4,5-tris(phenylmethoxy)-6-(phenylmethoxymethyl)oxan-2-yl]butan-2-one |
| SMILES | CC1(C)OC[C@H]([C@@H](O)[C@H](O)C(=O)C[C@H]2O[C@H](COCc3ccccc3)[C@@H](OCc3ccccc3)[C@H](OCc3ccccc3)[C@H]2OCc2ccccc2)O1 |
| InChI | InChI=1S/C43H50O10/c1-43(2)51-29-36(53-43)39(46)38(45)34(44)23-35-40(48-25-31-17-9-4-10-18-31)42(50-27-33-21-13-6-14-22-33)41(49-26-32-19-11-5-12-20-32)37(52-35)28-47-24-30-15-7-3-8-16-30/h3-22,35-42,45-46H,23-29H2,1-2H3/t35-,36-,37-,38-,39-,40+,41-,42-/m1/s1 |
| InChIKey | XRSVRCMPPBGYBB-WJGZZFPXSA-N |
| XLogP | 5.56 |
| TPSA | 122.14 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 18 |
| Heavy Atoms | 53 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 726.86 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 10 |