C33H36N12O6 — CID 11445417
(1R,2R,3S,5R,6S)-3,5-diazido-2-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-6-phenylmethoxycyclohexan-1-ol (PubChem CID 11445417) has the molecular formula C33H36N12O6 and a molecular weight of 696.73 g/mol. Its IUPAC name is (1R,2R,3S,5R,6S)-3,5-diazido-2-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-6-phenylmethoxycyclohexan-1-ol.
| Compound Name | (1R,2R,3S,5R,6S)-3,5-diazido-2-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-6-phenylmethoxycyclohexan-1-ol |
|---|---|
| PubChem CID | 11445417 |
| Molecular Formula | C33H36N12O6 |
| Molecular Weight | 696.73 g/mol |
| Exact Mass | 696.29 |
| IUPAC Name | (1R,2R,3S,5R,6S)-3,5-diazido-2-[(2R,3R,4R,5R,6R)-3-azido-6-(azidomethyl)-4,5-bis(phenylmethoxy)oxan-2-yl]oxy-6-phenylmethoxycyclohexan-1-ol |
| SMILES | [N-]=[N+]=NC[C@H]1O[C@H](O[C@H]2[C@H](O)[C@@H](OCc3ccccc3)[C@H](N=[N+]=[N-])C[C@@H]2N=[N+]=[N-])[C@H](N=[N+]=[N-])[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H36N12O6/c34-42-38-17-26-31(48-19-22-12-6-2-7-13-22)32(49-20-23-14-8-3-9-15-23)27(41-45-37)33(50-26)51-30-25(40-44-36)16-24(39-43-35)29(28(30)46)47-18-21-10-4-1-5-11-21/h1-15,24-33,46H,16-20H2/t24-,25+,26-,27-,28-,29+,30-,31-,32-,33-/m1/s1 |
| InChIKey | XQHGFQUTRKJYPQ-GYOPUMEISA-N |
| XLogP | 6.96 |
| TPSA | 261.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 10 |
| Rotatable Bonds | 16 |
| Heavy Atoms | 51 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 696.73 |
| LogP ≤ 5 | 6.96 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 10 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|