C33H40O7 — CID 10768982
(2R,3S,4R,5R,6S)-2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-6-methyl-3,4,5-tris(phenylmethoxy)oxane (PubChem CID 10768982) has the molecular formula C33H40O7 and a molecular weight of 548.68 g/mol. Its IUPAC name is (2R,3S,4R,5R,6S)-2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-6-methyl-3,4,5-tris(phenylmethoxy)oxane.
| Compound Name | (2R,3S,4R,5R,6S)-2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-6-methyl-3,4,5-tris(phenylmethoxy)oxane |
|---|---|
| PubChem CID | 10768982 |
| Molecular Formula | C33H40O7 |
| Molecular Weight | 548.68 g/mol |
| Exact Mass | 548.28 |
| IUPAC Name | (2R,3S,4R,5R,6S)-2-[[(4S)-2,2-dimethyl-1,3-dioxolan-4-yl]methoxy]-6-methyl-3,4,5-tris(phenylmethoxy)oxane |
| SMILES | C[C@@H]1O[C@@H](OC[C@H]2COC(C)(C)O2)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C33H40O7/c1-24-29(34-19-25-13-7-4-8-14-25)30(35-20-26-15-9-5-10-16-26)31(36-21-27-17-11-6-12-18-27)32(39-24)37-22-28-23-38-33(2,3)40-28/h4-18,24,28-32H,19-23H2,1-3H3/t24-,28-,29+,30+,31-,32+/m0/s1 |
| InChIKey | PSUVUHGXOBZMBV-PUBQURTRSA-N |
| XLogP | 5.66 |
| TPSA | 64.61 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 40 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 548.68 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 7 |