C13H17N3O4S — CID 175367891
(2-azidocyclopentyl)-phenylmethoxymethanesulfonic acid (PubChem CID 175367891) has the molecular formula C13H17N3O4S and a molecular weight of 311.36 g/mol. Its IUPAC name is (2-azidocyclopentyl)-phenylmethoxymethanesulfonic acid.
| Compound Name | (2-azidocyclopentyl)-phenylmethoxymethanesulfonic acid |
|---|---|
| PubChem CID | 175367891 |
| Molecular Formula | C13H17N3O4S |
| Molecular Weight | 311.36 g/mol |
| Exact Mass | 311.09 |
| IUPAC Name | (2-azidocyclopentyl)-phenylmethoxymethanesulfonic acid |
| SMILES | [N-]=[N+]=NC1CCCC1C(OCc1ccccc1)S(=O)(=O)O |
| InChI | InChI=1S/C13H17N3O4S/c14-16-15-12-8-4-7-11(12)13(21(17,18)19)20-9-10-5-2-1-3-6-10/h1-3,5-6,11-13H,4,7-9H2,(H,17,18,19) |
| InChIKey | BARKSUWHFTZWTP-UHFFFAOYSA-N |
| XLogP | 2.90 |
| TPSA | 112.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 311.36 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'}, {'alert_name': 'Sulfonic_acid_2', 'substructure': 'N/A'} |
|---|