About [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene
[(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene (PubChem CID 175450385) has the molecular formula C26H30N12O
and a molecular weight of 526.61 g/mol. Its IUPAC name is [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene.
Molecular Properties
| Compound Name | [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene |
| PubChem CID | 175450385 |
| Molecular Formula | C26H30N12O |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene |
| SMILES | [N-]=[N+]=NC1CCCC(C(OC(c2ccccc2)C2CCCC(N=[N+]=[N-])C2N=[N+]=[N-])c2ccccc2)C1N=[N+]=[N-] |
| InChI | InChI=1S/C26H30N12O/c27-35-31-21-15-7-13-19(23(21)33-37-29)25(17-9-3-1-4-10-17)39-26(18-11-5-2-6-12-18)20-14-8-16-22(32-36-28)24(20)34-38-30/h1-6,9-12,19-26H,7-8,13-16H2 |
| InChIKey | RBHVKRHHWOAWQF-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 204.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
Lipinski Rule of Five
2 violations
| Rule | Value |
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene?
The IUPAC name of [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene (CID 175450385) is [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene.
What is the SMILES notation for [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene?
The canonical SMILES for [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene is [N-]=[N+]=NC1CCCC(C(OC(c2ccccc2)C2CCCC(N=[N+]=[N-])C2N=[N+]=[N-])c2ccccc2)C1N=[N+]=[N-].
What is the InChIKey of [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene?
The InChIKey is RBHVKRHHWOAWQF-UHFFFAOYSA-N. The full InChI is InChI=1S/C26H30N12O/c27-35-31-21-15-7-13-19(23(21)33-37-29)25(17-9-3-1-4-10-17)39-26(18-11-5-2-6-12-18)20-14-8-16-22(32-36-28)24(20)34-38-30/h1-6,9-12,19-26H,7-8,13-16H2.
What are the key properties of [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene?
[(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene has a molecular weight of 526.61 g/mol, XLogP of 8.80, 10 rotatable bonds, 0 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene is sourced from PubChem (CID 175450385), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).