C26H30N12O — CID 175450385
[(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene (PubChem CID 175450385) has the molecular formula C26H30N12O and a molecular weight of 526.61 g/mol. Its IUPAC name is [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene.
| Compound Name | [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene |
|---|---|
| PubChem CID | 175450385 |
| Molecular Formula | C26H30N12O |
| Molecular Weight | 526.61 g/mol |
| Exact Mass | 526.27 |
| IUPAC Name | [(2,3-diazidocyclohexyl)-[(2,3-diazidocyclohexyl)-phenylmethoxy]methyl]benzene |
| SMILES | [N-]=[N+]=NC1CCCC(C(OC(c2ccccc2)C2CCCC(N=[N+]=[N-])C2N=[N+]=[N-])c2ccccc2)C1N=[N+]=[N-] |
| InChI | InChI=1S/C26H30N12O/c27-35-31-21-15-7-13-19(23(21)33-37-29)25(17-9-3-1-4-10-17)39-26(18-11-5-2-6-12-18)20-14-8-16-22(32-36-28)24(20)34-38-30/h1-6,9-12,19-26H,7-8,13-16H2 |
| InChIKey | RBHVKRHHWOAWQF-UHFFFAOYSA-N |
| XLogP | 8.80 |
| TPSA | 204.27 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 39 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 526.61 |
| LogP ≤ 5 | 8.80 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|