C7H5N3S2 — CID 12625264
2-azido-1,3-benzodithiole (PubChem CID 12625264) has the molecular formula C7H5N3S2 and a molecular weight of 195.27 g/mol. Its IUPAC name is 2-azido-1,3-benzodithiole.
| Compound Name | 2-azido-1,3-benzodithiole |
|---|---|
| PubChem CID | 12625264 |
| Molecular Formula | C7H5N3S2 |
| Molecular Weight | 195.27 g/mol |
| Exact Mass | 194.99 |
| IUPAC Name | 2-azido-1,3-benzodithiole |
| SMILES | [N-]=[N+]=NC1Sc2ccccc2S1 |
| InChI | InChI=1S/C7H5N3S2/c8-10-9-7-11-5-3-1-2-4-6(5)12-7/h1-4,7H |
| InChIKey | DUGYIYFMOVBNMK-UHFFFAOYSA-N |
| XLogP | 3.48 |
| TPSA | 48.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 195.27 |
| LogP ≤ 5 | 3.48 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|