C15H11N3O2 — CID 57331975
(3S,4S)-4-azido-3-phenyl-3,4-dihydroisochromen-1-one (PubChem CID 57331975) has the molecular formula C15H11N3O2 and a molecular weight of 265.27 g/mol. Its IUPAC name is (3S,4S)-4-azido-3-phenyl-3,4-dihydroisochromen-1-one.
| Compound Name | (3S,4S)-4-azido-3-phenyl-3,4-dihydroisochromen-1-one |
|---|---|
| PubChem CID | 57331975 |
| Molecular Formula | C15H11N3O2 |
| Molecular Weight | 265.27 g/mol |
| Exact Mass | 265.09 |
| IUPAC Name | (3S,4S)-4-azido-3-phenyl-3,4-dihydroisochromen-1-one |
| SMILES | [N-]=[N+]=N[C@H]1c2ccccc2C(=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C15H11N3O2/c16-18-17-13-11-8-4-5-9-12(11)15(19)20-14(13)10-6-2-1-3-7-10/h1-9,13-14H/t13-,14-/m0/s1 |
| InChIKey | VQHMQUOLPBPMKW-KBPBESRZSA-N |
| XLogP | 3.95 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 265.27 |
| LogP ≤ 5 | 3.95 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|