C10H9N3O2 — CID 10867402
(4R,5S)-4-azido-5-phenyloxolan-2-one (PubChem CID 10867402) has the molecular formula C10H9N3O2 and a molecular weight of 203.20 g/mol. Its IUPAC name is (4R,5S)-4-azido-5-phenyloxolan-2-one.
| Compound Name | (4R,5S)-4-azido-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 10867402 |
| Molecular Formula | C10H9N3O2 |
| Molecular Weight | 203.20 g/mol |
| Exact Mass | 203.07 |
| IUPAC Name | (4R,5S)-4-azido-5-phenyloxolan-2-one |
| SMILES | [N-]=[N+]=N[C@@H]1CC(=O)O[C@H]1c1ccccc1 |
| InChI | InChI=1S/C10H9N3O2/c11-13-12-8-6-9(14)15-10(8)7-4-2-1-3-5-7/h1-5,8,10H,6H2/t8-,10+/m1/s1 |
| InChIKey | XSAHCYHOSRRCGL-SCZZXKLOSA-N |
| XLogP | 2.35 |
| TPSA | 75.06 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 203.20 |
| LogP ≤ 5 | 2.35 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|