C12H14O3 — CID 11424286
(4S,5S)-4-(2-hydroxyethyl)-5-phenyloxolan-2-one (PubChem CID 11424286) has the molecular formula C12H14O3 and a molecular weight of 206.24 g/mol. Its IUPAC name is (4S,5S)-4-(2-hydroxyethyl)-5-phenyloxolan-2-one.
| Compound Name | (4S,5S)-4-(2-hydroxyethyl)-5-phenyloxolan-2-one |
|---|---|
| PubChem CID | 11424286 |
| Molecular Formula | C12H14O3 |
| Molecular Weight | 206.24 g/mol |
| Exact Mass | 206.09 |
| IUPAC Name | (4S,5S)-4-(2-hydroxyethyl)-5-phenyloxolan-2-one |
| SMILES | O=C1C[C@H](CCO)[C@@H](c2ccccc2)O1 |
| InChI | InChI=1S/C12H14O3/c13-7-6-10-8-11(14)15-12(10)9-4-2-1-3-5-9/h1-5,10,12-13H,6-8H2/t10-,12+/m0/s1 |
| InChIKey | NHHJDVSCPVVPPR-CMPLNLGQSA-N |
| XLogP | 1.67 |
| TPSA | 46.53 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 206.24 |
| LogP ≤ 5 | 1.67 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |