C21H23NO4 — CID 7451686
N-(4-ethoxyphenyl)-3-[(2S,3S)-5-oxo-2-phenyloxolan-3-yl]propanamide (PubChem CID 7451686) has the molecular formula C21H23NO4 and a molecular weight of 353.42 g/mol. Its IUPAC name is N-(4-ethoxyphenyl)-3-[(2S,3S)-5-oxo-2-phenyloxolan-3-yl]propanamide.
| Compound Name | N-(4-ethoxyphenyl)-3-[(2S,3S)-5-oxo-2-phenyloxolan-3-yl]propanamide |
|---|---|
| PubChem CID | 7451686 |
| Molecular Formula | C21H23NO4 |
| Molecular Weight | 353.42 g/mol |
| Exact Mass | 353.16 |
| IUPAC Name | N-(4-ethoxyphenyl)-3-[(2S,3S)-5-oxo-2-phenyloxolan-3-yl]propanamide |
| SMILES | CCOc1ccc(NC(=O)CC[C@H]2CC(=O)O[C@@H]2c2ccccc2)cc1 |
| InChI | InChI=1S/C21H23NO4/c1-2-25-18-11-9-17(10-12-18)22-19(23)13-8-16-14-20(24)26-21(16)15-6-4-3-5-7-15/h3-7,9-12,16,21H,2,8,13-14H2,1H3,(H,22,23)/t16-,21+/m0/s1 |
| InChIKey | LNTKWHMUQFZRFY-HRAATJIYSA-N |
| XLogP | 4.11 |
| TPSA | 64.63 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 353.42 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |