C8H6N6O — CID 71390027
(2R,3S)-2,3-diazido-2,3-dihydro-1-benzofuran (PubChem CID 71390027) has the molecular formula C8H6N6O and a molecular weight of 202.18 g/mol. Its IUPAC name is (2R,3S)-2,3-diazido-2,3-dihydro-1-benzofuran.
| Compound Name | (2R,3S)-2,3-diazido-2,3-dihydro-1-benzofuran |
|---|---|
| PubChem CID | 71390027 |
| Molecular Formula | C8H6N6O |
| Molecular Weight | 202.18 g/mol |
| Exact Mass | 202.06 |
| IUPAC Name | (2R,3S)-2,3-diazido-2,3-dihydro-1-benzofuran |
| SMILES | [N-]=[N+]=N[C@@H]1Oc2ccccc2[C@@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C8H6N6O/c9-13-11-7-5-3-1-2-4-6(5)15-8(7)12-14-10/h1-4,7-8H/t7-,8+/m0/s1 |
| InChIKey | FSGBENPHBYPGHB-JGVFFNPUSA-N |
| XLogP | 3.07 |
| TPSA | 106.75 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 202.18 |
| LogP ≤ 5 | 3.07 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|