About 4-azido-4H-1,3-benzodioxine
4-azido-4H-1,3-benzodioxine (PubChem CID 141368390) has the molecular formula C8H7N3O2
and a molecular weight of 177.16 g/mol. Its IUPAC name is 4-azido-4H-1,3-benzodioxine.
Molecular Properties
| Compound Name | 4-azido-4H-1,3-benzodioxine |
| PubChem CID | 141368390 |
| Molecular Formula | C8H7N3O2 |
| Molecular Weight | 177.16 g/mol |
| Exact Mass | 177.05 |
| IUPAC Name | 4-azido-4H-1,3-benzodioxine |
| SMILES | [N-]=[N+]=NC1OCOc2ccccc21 |
| InChI | InChI=1S/C8H7N3O2/c9-11-10-8-6-3-1-2-4-7(6)12-5-13-8/h1-4,8H,5H2 |
| InChIKey | MKSYNETUYDTXMD-UHFFFAOYSA-N |
| XLogP | 2.36 |
| TPSA | 67.22 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 177.16 |
| LogP ≤ 5 | 2.36 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|
Analyze 4-azido-4H-1,3-benzodioxine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-azido-4H-1,3-benzodioxine?
The IUPAC name of 4-azido-4H-1,3-benzodioxine (CID 141368390) is 4-azido-4H-1,3-benzodioxine.
What is the SMILES notation for 4-azido-4H-1,3-benzodioxine?
The canonical SMILES for 4-azido-4H-1,3-benzodioxine is [N-]=[N+]=NC1OCOc2ccccc21.
What is the InChIKey of 4-azido-4H-1,3-benzodioxine?
The InChIKey is MKSYNETUYDTXMD-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H7N3O2/c9-11-10-8-6-3-1-2-4-7(6)12-5-13-8/h1-4,8H,5H2.
What are the key properties of 4-azido-4H-1,3-benzodioxine?
4-azido-4H-1,3-benzodioxine has a molecular weight of 177.16 g/mol, XLogP of 2.36, 1 rotatable bonds, 0 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for 4-azido-4H-1,3-benzodioxine is sourced from PubChem (CID 141368390), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).