C22H16N6O2 — CID 12884697
6,13-diazido-5,6,12,13-tetrahydronaphtho[1,2-b]phenanthrene-5,12-diol (PubChem CID 12884697) has the molecular formula C22H16N6O2 and a molecular weight of 396.41 g/mol. Its IUPAC name is 6,13-diazido-5,6,12,13-tetrahydronaphtho[1,2-b]phenanthrene-5,12-diol.
| Compound Name | 6,13-diazido-5,6,12,13-tetrahydronaphtho[1,2-b]phenanthrene-5,12-diol |
|---|---|
| PubChem CID | 12884697 |
| Molecular Formula | C22H16N6O2 |
| Molecular Weight | 396.41 g/mol |
| Exact Mass | 396.13 |
| IUPAC Name | 6,13-diazido-5,6,12,13-tetrahydronaphtho[1,2-b]phenanthrene-5,12-diol |
| SMILES | [N-]=[N+]=NC1c2cc3c(cc2-c2ccccc2C1O)C(N=[N+]=[N-])C(O)c1ccccc1-3 |
| InChI | InChI=1S/C22H16N6O2/c23-27-25-19-17-10-16-12-6-2-4-8-14(12)22(30)20(26-28-24)18(16)9-15(17)11-5-1-3-7-13(11)21(19)29/h1-10,19-22,29-30H |
| InChIKey | QAEVFXFDGPZPTI-UHFFFAOYSA-N |
| XLogP | 5.82 |
| TPSA | 137.98 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 396.41 |
| LogP ≤ 5 | 5.82 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|