C19H12N4O — CID 10519164
(4R,5R)-5-azido-4,5-dihydropyreno[1,2-b]pyridin-4-ol (PubChem CID 10519164) has the molecular formula C19H12N4O and a molecular weight of 312.33 g/mol. Its IUPAC name is (4R,5R)-5-azido-4,5-dihydropyreno[1,2-b]pyridin-4-ol.
| Compound Name | (4R,5R)-5-azido-4,5-dihydropyreno[1,2-b]pyridin-4-ol |
|---|---|
| PubChem CID | 10519164 |
| Molecular Formula | C19H12N4O |
| Molecular Weight | 312.33 g/mol |
| Exact Mass | 312.10 |
| IUPAC Name | (4R,5R)-5-azido-4,5-dihydropyreno[1,2-b]pyridin-4-ol |
| SMILES | [N-]=[N+]=N[C@@H]1c2cc3cccnc3c3ccc4cccc(c4c23)[C@H]1O |
| InChI | InChI=1S/C19H12N4O/c20-23-22-18-14-9-11-4-2-8-21-17(11)12-7-6-10-3-1-5-13(19(18)24)15(10)16(12)14/h1-9,18-19,24H/t18-,19-/m1/s1 |
| InChIKey | KDNLCXKBEUXTOF-RTBURBONSA-N |
| XLogP | 4.94 |
| TPSA | 81.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 312.33 |
| LogP ≤ 5 | 4.94 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|