C21H14N4O — CID 11724683
(10S,11R)-10-azido-13-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17,19,21-decaen-11-ol (PubChem CID 11724683) has the molecular formula C21H14N4O and a molecular weight of 338.37 g/mol. Its IUPAC name is (10S,11R)-10-azido-13-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17,19,21-decaen-11-ol.
| Compound Name | (10S,11R)-10-azido-13-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17,19,21-decaen-11-ol |
|---|---|
| PubChem CID | 11724683 |
| Molecular Formula | C21H14N4O |
| Molecular Weight | 338.37 g/mol |
| Exact Mass | 338.12 |
| IUPAC Name | (10S,11R)-10-azido-13-azapentacyclo[12.8.0.03,12.04,9.017,22]docosa-1,3(12),4,6,8,13,15,17,19,21-decaen-11-ol |
| SMILES | [N-]=[N+]=N[C@H]1c2ccccc2-c2cc3c(ccc4ccccc43)nc2[C@@H]1O |
| InChI | InChI=1S/C21H14N4O/c22-25-24-20-15-8-4-3-7-14(15)17-11-16-13-6-2-1-5-12(13)9-10-18(16)23-19(17)21(20)26/h1-11,20-21,26H/t20-,21-/m0/s1 |
| InChIKey | LZGIUGAYFQKUGT-SFTDATJTSA-N |
| XLogP | 5.45 |
| TPSA | 81.88 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 338.37 |
| LogP ≤ 5 | 5.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'Polycyclic_aromatic_hydrocarbon_3', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|