C14H11N5O2 — CID 102390884
[(5R,6R)-6-azido-5,6-dihydro-1,10-phenanthrolin-5-yl] acetate (PubChem CID 102390884) has the molecular formula C14H11N5O2 and a molecular weight of 281.28 g/mol. Its IUPAC name is [(5R,6R)-6-azido-5,6-dihydro-1,10-phenanthrolin-5-yl] acetate.
| Compound Name | [(5R,6R)-6-azido-5,6-dihydro-1,10-phenanthrolin-5-yl] acetate |
|---|---|
| PubChem CID | 102390884 |
| Molecular Formula | C14H11N5O2 |
| Molecular Weight | 281.28 g/mol |
| Exact Mass | 281.09 |
| IUPAC Name | [(5R,6R)-6-azido-5,6-dihydro-1,10-phenanthrolin-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1c2cccnc2-c2ncccc2[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C14H11N5O2/c1-8(20)21-14-10-5-3-7-17-12(10)11-9(4-2-6-16-11)13(14)18-19-15/h2-7,13-14H,1H3/t13-,14-/m1/s1 |
| InChIKey | AMOISHRJVWKTGY-ZIAGYGMSSA-N |
| XLogP | 3.11 |
| TPSA | 100.84 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 281.28 |
| LogP ≤ 5 | 3.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|