C18H17F2NO3 — CID 67115825
[(5S,6S,9R)-6-(2,3-difluorophenyl)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl] acetate (PubChem CID 67115825) has the molecular formula C18H17F2NO3 and a molecular weight of 333.33 g/mol. Its IUPAC name is [(5S,6S,9R)-6-(2,3-difluorophenyl)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl] acetate.
| Compound Name | [(5S,6S,9R)-6-(2,3-difluorophenyl)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl] acetate |
|---|---|
| PubChem CID | 67115825 |
| Molecular Formula | C18H17F2NO3 |
| Molecular Weight | 333.33 g/mol |
| Exact Mass | 333.12 |
| IUPAC Name | [(5S,6S,9R)-6-(2,3-difluorophenyl)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl] acetate |
| SMILES | CC(=O)O[C@@H]1c2cccnc2[C@H](O)CC[C@H]1c1cccc(F)c1F |
| InChI | InChI=1S/C18H17F2NO3/c1-10(22)24-18-12(11-4-2-6-14(19)16(11)20)7-8-15(23)17-13(18)5-3-9-21-17/h2-6,9,12,15,18,23H,7-8H2,1H3/t12-,15+,18-/m0/s1 |
| InChIKey | GNOAEFHOHLWQKV-PNPHSEOMSA-N |
| XLogP | 3.58 |
| TPSA | 59.42 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 333.33 |
| LogP ≤ 5 | 3.58 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |