C21H25F2N3O2 — CID 67115949
[(5S,6R,9R)-9-amino-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl]-tert-butylcarbamic acid (PubChem CID 67115949) has the molecular formula C21H25F2N3O2 and a molecular weight of 389.45 g/mol. Its IUPAC name is [(5S,6R,9R)-9-amino-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl]-tert-butylcarbamic acid.
| Compound Name | [(5S,6R,9R)-9-amino-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl]-tert-butylcarbamic acid |
|---|---|
| PubChem CID | 67115949 |
| Molecular Formula | C21H25F2N3O2 |
| Molecular Weight | 389.45 g/mol |
| Exact Mass | 389.19 |
| IUPAC Name | [(5S,6R,9R)-9-amino-6-(2,3-difluorophenyl)-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl]-tert-butylcarbamic acid |
| SMILES | CC(C)(C)N(C(=O)O)[C@@H]1c2cccnc2[C@H](N)CC[C@@H]1c1cccc(F)c1F |
| InChI | InChI=1S/C21H25F2N3O2/c1-21(2,3)26(20(27)28)19-13(12-6-4-8-15(22)17(12)23)9-10-16(24)18-14(19)7-5-11-25-18/h4-8,11,13,16,19H,9-10,24H2,1-3H3,(H,27,28)/t13-,16-,19+/m1/s1 |
| InChIKey | XISFVLOSZWXXGS-NRXGSXMXSA-N |
| XLogP | 4.76 |
| TPSA | 79.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.45 |
| LogP ≤ 5 | 4.76 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |