C17H16ClF2N — CID 58468013
(5R,6S,9R)-5-chloro-6-(2,3-difluorophenyl)-9-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine (PubChem CID 58468013) has the molecular formula C17H16ClF2N and a molecular weight of 307.77 g/mol. Its IUPAC name is (5R,6S,9R)-5-chloro-6-(2,3-difluorophenyl)-9-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine.
| Compound Name | (5R,6S,9R)-5-chloro-6-(2,3-difluorophenyl)-9-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine |
|---|---|
| PubChem CID | 58468013 |
| Molecular Formula | C17H16ClF2N |
| Molecular Weight | 307.77 g/mol |
| Exact Mass | 307.09 |
| IUPAC Name | (5R,6S,9R)-5-chloro-6-(2,3-difluorophenyl)-9-methyl-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridine |
| SMILES | C[C@@H]1CC[C@@H](c2cccc(F)c2F)[C@@H](Cl)c2cccnc21 |
| InChI | InChI=1S/C17H16ClF2N/c1-10-7-8-11(12-4-2-6-14(19)16(12)20)15(18)13-5-3-9-21-17(10)13/h2-6,9-11,15H,7-8H2,1H3/t10-,11+,15-/m1/s1 |
| InChIKey | LGABAOHQECANHB-JRPNMDOOSA-N |
| XLogP | 5.32 |
| TPSA | 12.89 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 307.77 |
| LogP ≤ 5 | 5.32 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|