C12H14F2O — CID 64908800
3-(2,3-difluorophenyl)-2-methylcyclopentan-1-ol (PubChem CID 64908800) has the molecular formula C12H14F2O and a molecular weight of 212.24 g/mol. Its IUPAC name is 3-(2,3-difluorophenyl)-2-methylcyclopentan-1-ol.
| Compound Name | 3-(2,3-difluorophenyl)-2-methylcyclopentan-1-ol |
|---|---|
| PubChem CID | 64908800 |
| Molecular Formula | C12H14F2O |
| Molecular Weight | 212.24 g/mol |
| Exact Mass | 212.10 |
| IUPAC Name | 3-(2,3-difluorophenyl)-2-methylcyclopentan-1-ol |
| SMILES | CC1C(O)CCC1c1cccc(F)c1F |
| InChI | InChI=1S/C12H14F2O/c1-7-8(5-6-11(7)15)9-3-2-4-10(13)12(9)14/h2-4,7-8,11,15H,5-6H2,1H3 |
| InChIKey | LBMNXQHBRSOZDN-UHFFFAOYSA-N |
| XLogP | 2.84 |
| TPSA | 20.23 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.24 |
| LogP ≤ 5 | 2.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |