C25H36F2N2OSi — CID 90122589
(5R,6R,9R)-6-(2,3-difluorophenyl)-9-tri(propan-2-yl)silyloxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-amine (PubChem CID 90122589) has the molecular formula C25H36F2N2OSi and a molecular weight of 446.66 g/mol. Its IUPAC name is (5R,6R,9R)-6-(2,3-difluorophenyl)-9-tri(propan-2-yl)silyloxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-amine.
| Compound Name | (5R,6R,9R)-6-(2,3-difluorophenyl)-9-tri(propan-2-yl)silyloxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-amine |
|---|---|
| PubChem CID | 90122589 |
| Molecular Formula | C25H36F2N2OSi |
| Molecular Weight | 446.66 g/mol |
| Exact Mass | 446.26 |
| IUPAC Name | (5R,6R,9R)-6-(2,3-difluorophenyl)-9-tri(propan-2-yl)silyloxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-amine |
| SMILES | CC(C)[Si](O[C@@H]1CC[C@H](c2cccc(F)c2F)[C@@H](N)c2cccnc21)(C(C)C)C(C)C |
| InChI | InChI=1S/C25H36F2N2OSi/c1-15(2)31(16(3)4,17(5)6)30-22-13-12-19(18-9-7-11-21(26)23(18)27)24(28)20-10-8-14-29-25(20)22/h7-11,14-17,19,22,24H,12-13,28H2,1-6H3/t19-,22-,24-/m1/s1 |
| InChIKey | SNGLNEOTYPIRQO-ZFJSRUIDSA-N |
| XLogP | 7.17 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 446.66 |
| LogP ≤ 5 | 7.17 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|