C21H24F2N2O3 — CID 58467988
tert-butyl N-[(5S,6S,9R)-6-(2,3-difluorophenyl)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl]carbamate (PubChem CID 58467988) has the molecular formula C21H24F2N2O3 and a molecular weight of 390.43 g/mol. Its IUPAC name is tert-butyl N-[(5S,6S,9R)-6-(2,3-difluorophenyl)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl]carbamate.
| Compound Name | tert-butyl N-[(5S,6S,9R)-6-(2,3-difluorophenyl)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl]carbamate |
|---|---|
| PubChem CID | 58467988 |
| Molecular Formula | C21H24F2N2O3 |
| Molecular Weight | 390.43 g/mol |
| Exact Mass | 390.18 |
| IUPAC Name | tert-butyl N-[(5S,6S,9R)-6-(2,3-difluorophenyl)-9-hydroxy-6,7,8,9-tetrahydro-5H-cyclohepta[b]pyridin-5-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@@H]1c2cccnc2[C@H](O)CC[C@H]1c1cccc(F)c1F |
| InChI | InChI=1S/C21H24F2N2O3/c1-21(2,3)28-20(27)25-18-13(12-6-4-8-15(22)17(12)23)9-10-16(26)19-14(18)7-5-11-24-19/h4-8,11,13,16,18,26H,9-10H2,1-3H3,(H,25,27)/t13-,16+,18-/m0/s1 |
| InChIKey | YNIAAQHUSABKJA-XCRHUMRWSA-N |
| XLogP | 4.54 |
| TPSA | 71.45 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 390.43 |
| LogP ≤ 5 | 4.54 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |