C13H15FN2O3 — CID 155681321
tert-butyl N-(7-fluoro-2-oxo-1,3-dihydroindol-3-yl)carbamate (PubChem CID 155681321) has the molecular formula C13H15FN2O3 and a molecular weight of 266.27 g/mol. Its IUPAC name is tert-butyl N-(7-fluoro-2-oxo-1,3-dihydroindol-3-yl)carbamate.
| Compound Name | tert-butyl N-(7-fluoro-2-oxo-1,3-dihydroindol-3-yl)carbamate |
|---|---|
| PubChem CID | 155681321 |
| Molecular Formula | C13H15FN2O3 |
| Molecular Weight | 266.27 g/mol |
| Exact Mass | 266.11 |
| IUPAC Name | tert-butyl N-(7-fluoro-2-oxo-1,3-dihydroindol-3-yl)carbamate |
| SMILES | CC(C)(C)OC(=O)NC1C(=O)Nc2c(F)cccc21 |
| InChI | InChI=1S/C13H15FN2O3/c1-13(2,3)19-12(18)16-10-7-5-4-6-8(14)9(7)15-11(10)17/h4-6,10H,1-3H3,(H,15,17)(H,16,18) |
| InChIKey | BXYUBMLQAUCPBB-UHFFFAOYSA-N |
| XLogP | 2.34 |
| TPSA | 67.43 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.27 |
| LogP ≤ 5 | 2.34 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 3 |