C14H17IN2O4 — CID 139416171
tert-butyl N-[(3S)-6-iodo-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate (PubChem CID 139416171) has the molecular formula C14H17IN2O4 and a molecular weight of 404.20 g/mol. Its IUPAC name is tert-butyl N-[(3S)-6-iodo-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-6-iodo-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 139416171 |
| Molecular Formula | C14H17IN2O4 |
| Molecular Weight | 404.20 g/mol |
| Exact Mass | 404.02 |
| IUPAC Name | tert-butyl N-[(3S)-6-iodo-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)N[C@H]1COc2cccc(I)c2NC1=O |
| InChI | InChI=1S/C14H17IN2O4/c1-14(2,3)21-13(19)16-9-7-20-10-6-4-5-8(15)11(10)17-12(9)18/h4-6,9H,7H2,1-3H3,(H,16,19)(H,17,18)/t9-/m0/s1 |
| InChIKey | LYGRBCVEXRUAMY-VIFPVBQESA-N |
| XLogP | 2.52 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 404.20 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|