C17H22N2O6 — CID 167005354
tert-butyl N-[(3S)-7-(2-methoxyoxiran-2-yl)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate (PubChem CID 167005354) has the molecular formula C17H22N2O6 and a molecular weight of 350.37 g/mol. Its IUPAC name is tert-butyl N-[(3S)-7-(2-methoxyoxiran-2-yl)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[(3S)-7-(2-methoxyoxiran-2-yl)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 167005354 |
| Molecular Formula | C17H22N2O6 |
| Molecular Weight | 350.37 g/mol |
| Exact Mass | 350.15 |
| IUPAC Name | tert-butyl N-[(3S)-7-(2-methoxyoxiran-2-yl)-4-oxo-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate |
| SMILES | COC1(c2ccc3c(c2)NC(=O)[C@@H](NC(=O)OC(C)(C)C)CO3)CO1 |
| InChI | InChI=1S/C17H22N2O6/c1-16(2,3)25-15(21)19-12-8-23-13-6-5-10(17(22-4)9-24-17)7-11(13)18-14(12)20/h5-7,12H,8-9H2,1-4H3,(H,18,20)(H,19,21)/t12-,17?/m0/s1 |
| InChIKey | VFWOLGPVMSGJRG-WHUIICBVSA-N |
| XLogP | 1.74 |
| TPSA | 98.42 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 350.37 |
| LogP ≤ 5 | 1.74 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|