C15H17BrN2O4 — CID 176535961
tert-butyl N-[7-bromo-4-(oxomethylidene)-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate (PubChem CID 176535961) has the molecular formula C15H17BrN2O4 and a molecular weight of 369.22 g/mol. Its IUPAC name is tert-butyl N-[7-bromo-4-(oxomethylidene)-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate.
| Compound Name | tert-butyl N-[7-bromo-4-(oxomethylidene)-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate |
|---|---|
| PubChem CID | 176535961 |
| Molecular Formula | C15H17BrN2O4 |
| Molecular Weight | 369.22 g/mol |
| Exact Mass | 368.04 |
| IUPAC Name | tert-butyl N-[7-bromo-4-(oxomethylidene)-3,5-dihydro-2H-1,5-benzoxazepin-3-yl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1COc2ccc(Br)cc2NC1=C=O |
| InChI | InChI=1S/C15H17BrN2O4/c1-15(2,3)22-14(20)18-12-8-21-13-5-4-9(16)6-10(13)17-11(12)7-19/h4-6,12,17H,8H2,1-3H3,(H,18,20) |
| InChIKey | KNJUYWZVXCESQF-UHFFFAOYSA-N |
| XLogP | 2.86 |
| TPSA | 76.66 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 22 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.22 |
| LogP ≤ 5 | 2.86 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'ketene', 'substructure': 'N/A'} |
|---|