C11H9F3N2O2 — CID 2966431
N-[2-oxo-7-(trifluoromethyl)-1,3-dihydroindol-3-yl]acetamide (PubChem CID 2966431) has the molecular formula C11H9F3N2O2 and a molecular weight of 258.20 g/mol. Its IUPAC name is N-[2-oxo-7-(trifluoromethyl)-1,3-dihydroindol-3-yl]acetamide.
| Compound Name | N-[2-oxo-7-(trifluoromethyl)-1,3-dihydroindol-3-yl]acetamide |
|---|---|
| PubChem CID | 2966431 |
| Molecular Formula | C11H9F3N2O2 |
| Molecular Weight | 258.20 g/mol |
| Exact Mass | 258.06 |
| IUPAC Name | N-[2-oxo-7-(trifluoromethyl)-1,3-dihydroindol-3-yl]acetamide |
| SMILES | CC(=O)NC1C(=O)Nc2c1cccc2C(F)(F)F |
| InChI | InChI=1S/C11H9F3N2O2/c1-5(17)15-9-6-3-2-4-7(11(12,13)14)8(6)16-10(9)18/h2-4,9H,1H3,(H,15,17)(H,16,18) |
| InChIKey | FAYWFKQYZYOVAO-UHFFFAOYSA-N |
| XLogP | 1.83 |
| TPSA | 58.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 258.20 |
| LogP ≤ 5 | 1.83 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |