C20H22F2N2O3 — CID 154972473
tert-butyl N-[2-[2-fluoro-6-[(2-fluoro-3-pyridinyl)methoxy]phenyl]cyclopropyl]carbamate (PubChem CID 154972473) has the molecular formula C20H22F2N2O3 and a molecular weight of 376.40 g/mol. Its IUPAC name is tert-butyl N-[2-[2-fluoro-6-[(2-fluoro-3-pyridinyl)methoxy]phenyl]cyclopropyl]carbamate.
| Compound Name | tert-butyl N-[2-[2-fluoro-6-[(2-fluoro-3-pyridinyl)methoxy]phenyl]cyclopropyl]carbamate |
|---|---|
| PubChem CID | 154972473 |
| Molecular Formula | C20H22F2N2O3 |
| Molecular Weight | 376.40 g/mol |
| Exact Mass | 376.16 |
| IUPAC Name | tert-butyl N-[2-[2-fluoro-6-[(2-fluoro-3-pyridinyl)methoxy]phenyl]cyclopropyl]carbamate |
| SMILES | CC(C)(C)OC(=O)NC1CC1c1c(F)cccc1OCc1cccnc1F |
| InChI | InChI=1S/C20H22F2N2O3/c1-20(2,3)27-19(25)24-15-10-13(15)17-14(21)7-4-8-16(17)26-11-12-6-5-9-23-18(12)22/h4-9,13,15H,10-11H2,1-3H3,(H,24,25) |
| InChIKey | SEWSIBWHLSFFCF-UHFFFAOYSA-N |
| XLogP | 4.32 |
| TPSA | 60.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.40 |
| LogP ≤ 5 | 4.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': '2-halo_pyridine', 'substructure': 'N/A'} |
|---|