C18H16F3NO2 — CID 158660838
1-[(5S,8S)-8-hydroxy-5,6,7,8-tetrahydroquinolin-5-yl]-3-(2,3,4-trifluorophenyl)propan-1-one (PubChem CID 158660838) has the molecular formula C18H16F3NO2 and a molecular weight of 335.33 g/mol. Its IUPAC name is 1-[(5S,8S)-8-hydroxy-5,6,7,8-tetrahydroquinolin-5-yl]-3-(2,3,4-trifluorophenyl)propan-1-one.
| Compound Name | 1-[(5S,8S)-8-hydroxy-5,6,7,8-tetrahydroquinolin-5-yl]-3-(2,3,4-trifluorophenyl)propan-1-one |
|---|---|
| PubChem CID | 158660838 |
| Molecular Formula | C18H16F3NO2 |
| Molecular Weight | 335.33 g/mol |
| Exact Mass | 335.11 |
| IUPAC Name | 1-[(5S,8S)-8-hydroxy-5,6,7,8-tetrahydroquinolin-5-yl]-3-(2,3,4-trifluorophenyl)propan-1-one |
| SMILES | O=C(CCc1ccc(F)c(F)c1F)[C@H]1CC[C@H](O)c2ncccc21 |
| InChI | InChI=1S/C18H16F3NO2/c19-13-6-3-10(16(20)17(13)21)4-7-14(23)11-5-8-15(24)18-12(11)2-1-9-22-18/h1-3,6,9,11,15,24H,4-5,7-8H2/t11-,15-/m0/s1 |
| InChIKey | ICSVASKRGGPPRJ-NHYWBVRUSA-N |
| XLogP | 3.61 |
| TPSA | 50.19 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 335.33 |
| LogP ≤ 5 | 3.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'halogenated_ring_2', 'substructure': 'N/A'} |
|---|