C12H9ClN2O — CID 15356186
(5R,6R)-6-chloro-5,6-dihydro-1,10-phenanthrolin-5-ol (PubChem CID 15356186) has the molecular formula C12H9ClN2O and a molecular weight of 232.67 g/mol. Its IUPAC name is (5R,6R)-6-chloro-5,6-dihydro-1,10-phenanthrolin-5-ol.
| Compound Name | (5R,6R)-6-chloro-5,6-dihydro-1,10-phenanthrolin-5-ol |
|---|---|
| PubChem CID | 15356186 |
| Molecular Formula | C12H9ClN2O |
| Molecular Weight | 232.67 g/mol |
| Exact Mass | 232.04 |
| IUPAC Name | (5R,6R)-6-chloro-5,6-dihydro-1,10-phenanthrolin-5-ol |
| SMILES | O[C@@H]1c2cccnc2-c2ncccc2[C@H]1Cl |
| InChI | InChI=1S/C12H9ClN2O/c13-9-7-3-1-5-14-10(7)11-8(12(9)16)4-2-6-15-11/h1-6,9,12,16H/t9-,12-/m1/s1 |
| InChIKey | PXCZMNMKUCWYCN-BXKDBHETSA-N |
| XLogP | 2.47 |
| TPSA | 46.01 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 232.67 |
| LogP ≤ 5 | 2.47 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|