C20H24N4O10 — CID 102442992
methyl 2-[[(2R,3R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl]oxymethyl]pyridine-3-carboxylate (PubChem CID 102442992) has the molecular formula C20H24N4O10 and a molecular weight of 480.43 g/mol. Its IUPAC name is methyl 2-[[(2R,3R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl]oxymethyl]pyridine-3-carboxylate.
| Compound Name | methyl 2-[[(2R,3R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl]oxymethyl]pyridine-3-carboxylate |
|---|---|
| PubChem CID | 102442992 |
| Molecular Formula | C20H24N4O10 |
| Molecular Weight | 480.43 g/mol |
| Exact Mass | 480.15 |
| IUPAC Name | methyl 2-[[(2R,3R,4R,5R,6R)-4,5-diacetyloxy-6-(acetyloxymethyl)-3-azidooxan-2-yl]oxymethyl]pyridine-3-carboxylate |
| SMILES | COC(=O)c1cccnc1CO[C@@H]1O[C@H](COC(C)=O)[C@H](OC(C)=O)[C@H](OC(C)=O)[C@H]1N=[N+]=[N-] |
| InChI | InChI=1S/C20H24N4O10/c1-10(25)30-9-15-17(32-11(2)26)18(33-12(3)27)16(23-24-21)20(34-15)31-8-14-13(19(28)29-4)6-5-7-22-14/h5-7,15-18,20H,8-9H2,1-4H3/t15-,16-,17+,18-,20-/m1/s1 |
| InChIKey | GWNHXLOQOYAJHO-BFMVXSJESA-N |
| XLogP | 1.22 |
| TPSA | 185.31 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 12 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 34 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 480.43 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 12 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': '>_2_ester_groups', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|