C16H9F6N3O — CID 22296158
(9R,10R)-10-azido-3,6-bis(trifluoromethyl)-9,10-dihydrophenanthren-9-ol (PubChem CID 22296158) has the molecular formula C16H9F6N3O and a molecular weight of 373.26 g/mol. Its IUPAC name is (9R,10R)-10-azido-3,6-bis(trifluoromethyl)-9,10-dihydrophenanthren-9-ol.
| Compound Name | (9R,10R)-10-azido-3,6-bis(trifluoromethyl)-9,10-dihydrophenanthren-9-ol |
|---|---|
| PubChem CID | 22296158 |
| Molecular Formula | C16H9F6N3O |
| Molecular Weight | 373.26 g/mol |
| Exact Mass | 373.06 |
| IUPAC Name | (9R,10R)-10-azido-3,6-bis(trifluoromethyl)-9,10-dihydrophenanthren-9-ol |
| SMILES | [N-]=[N+]=N[C@@H]1c2ccc(C(F)(F)F)cc2-c2cc(C(F)(F)F)ccc2[C@H]1O |
| InChI | InChI=1S/C16H9F6N3O/c17-15(18,19)7-1-3-9-11(5-7)12-6-8(16(20,21)22)2-4-10(12)14(26)13(9)24-25-23/h1-6,13-14,26H/t13-,14-/m1/s1 |
| InChIKey | XUVLBOHSSZIQRA-ZIAGYGMSSA-N |
| XLogP | 5.79 |
| TPSA | 68.99 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 1 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.26 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|