C24H37N3O6 — CID 10647792
[(3S,4R,5R)-6-hydroxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-yl] (1S,2S,3S)-3-azido-2-phenylmethoxycyclohexane-1-carboxylate (PubChem CID 10647792) has the molecular formula C24H37N3O6 and a molecular weight of 463.58 g/mol. Its IUPAC name is [(3S,4R,5R)-6-hydroxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-yl] (1S,2S,3S)-3-azido-2-phenylmethoxycyclohexane-1-carboxylate.
| Compound Name | [(3S,4R,5R)-6-hydroxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-yl] (1S,2S,3S)-3-azido-2-phenylmethoxycyclohexane-1-carboxylate |
|---|---|
| PubChem CID | 10647792 |
| Molecular Formula | C24H37N3O6 |
| Molecular Weight | 463.58 g/mol |
| Exact Mass | 463.27 |
| IUPAC Name | [(3S,4R,5R)-6-hydroxy-4-(methoxymethoxy)-2,5-dimethylhexan-3-yl] (1S,2S,3S)-3-azido-2-phenylmethoxycyclohexane-1-carboxylate |
| SMILES | COCO[C@H]([C@H](C)CO)[C@@H](OC(=O)[C@H]1CCC[C@H](N=[N+]=[N-])[C@H]1OCc1ccccc1)C(C)C |
| InChI | InChI=1S/C24H37N3O6/c1-16(2)21(22(17(3)13-28)32-15-30-4)33-24(29)19-11-8-12-20(26-27-25)23(19)31-14-18-9-6-5-7-10-18/h5-7,9-10,16-17,19-23,28H,8,11-15H2,1-4H3/t17-,19+,20+,21+,22-,23+/m1/s1 |
| InChIKey | LYSQFWCFFJLFSX-PJTLEZBXSA-N |
| XLogP | 4.24 |
| TPSA | 122.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 463.58 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'het-C-het_not_in_ring', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|