C29H29N3O5 — CID 56641543
benzyl (1S,2R,3S,7R)-7-azido-4-oxo-2,3-bis(phenylmethoxy)cycloheptane-1-carboxylate (PubChem CID 56641543) has the molecular formula C29H29N3O5 and a molecular weight of 499.57 g/mol. Its IUPAC name is benzyl (1S,2R,3S,7R)-7-azido-4-oxo-2,3-bis(phenylmethoxy)cycloheptane-1-carboxylate.
| Compound Name | benzyl (1S,2R,3S,7R)-7-azido-4-oxo-2,3-bis(phenylmethoxy)cycloheptane-1-carboxylate |
|---|---|
| PubChem CID | 56641543 |
| Molecular Formula | C29H29N3O5 |
| Molecular Weight | 499.57 g/mol |
| Exact Mass | 499.21 |
| IUPAC Name | benzyl (1S,2R,3S,7R)-7-azido-4-oxo-2,3-bis(phenylmethoxy)cycloheptane-1-carboxylate |
| SMILES | [N-]=[N+]=N[C@@H]1CCC(=O)[C@@H](OCc2ccccc2)[C@H](OCc2ccccc2)[C@H]1C(=O)OCc1ccccc1 |
| InChI | InChI=1S/C29H29N3O5/c30-32-31-24-16-17-25(33)27(35-18-21-10-4-1-5-11-21)28(36-19-22-12-6-2-7-13-22)26(24)29(34)37-20-23-14-8-3-9-15-23/h1-15,24,26-28H,16-20H2/t24-,26+,27-,28-/m1/s1 |
| InChIKey | NAOLDVQRUOIMRU-KCPYNUOSSA-N |
| XLogP | 5.56 |
| TPSA | 110.59 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 37 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 499.57 |
| LogP ≤ 5 | 5.56 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'azo_A(324)', 'substructure': 'N/A'}, {'alert_name': 'Azido_group', 'substructure': 'N/A'}, {'alert_name': 'diazo_group', 'substructure': 'N/A'}, {'alert_name': 'quaternary_nitrogen_3', 'substructure': 'N/A'} |
|---|