C43H43NO6 — CID 13006318
benzyl N-benzyl-N-[(1R,2R,3R,4S)-5-oxo-2,3,4-tris(phenylmethoxy)cycloheptyl]carbamate (PubChem CID 13006318) has the molecular formula C43H43NO6 and a molecular weight of 669.82 g/mol. Its IUPAC name is benzyl N-benzyl-N-[(1R,2R,3R,4S)-5-oxo-2,3,4-tris(phenylmethoxy)cycloheptyl]carbamate.
| Compound Name | benzyl N-benzyl-N-[(1R,2R,3R,4S)-5-oxo-2,3,4-tris(phenylmethoxy)cycloheptyl]carbamate |
|---|---|
| PubChem CID | 13006318 |
| Molecular Formula | C43H43NO6 |
| Molecular Weight | 669.82 g/mol |
| Exact Mass | 669.31 |
| IUPAC Name | benzyl N-benzyl-N-[(1R,2R,3R,4S)-5-oxo-2,3,4-tris(phenylmethoxy)cycloheptyl]carbamate |
| SMILES | O=C1CC[C@@H](N(Cc2ccccc2)C(=O)OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]1OCc1ccccc1 |
| InChI | InChI=1S/C43H43NO6/c45-39-27-26-38(44(28-33-16-6-1-7-17-33)43(46)50-32-37-24-14-5-15-25-37)40(47-29-34-18-8-2-9-19-34)42(49-31-36-22-12-4-13-23-36)41(39)48-30-35-20-10-3-11-21-35/h1-25,38,40-42H,26-32H2/t38-,40-,41-,42-/m1/s1 |
| InChIKey | AJJIJNHYXIEQHX-CSDKGPBGSA-N |
| XLogP | 8.31 |
| TPSA | 74.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 14 |
| Heavy Atoms | 50 |
| Complexity | — |
2 violations
| Rule | Value |
|---|---|
| MW ≤ 500 | 669.82 |
| LogP ≤ 5 | 8.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 6 |