C25H30N2O4 — CID 167445473
tert-butyl 2-[benzyl(phenylmethoxycarbonyl)amino]-6-azabicyclo[3.1.0]hexane-6-carboxylate (PubChem CID 167445473) has the molecular formula C25H30N2O4 and a molecular weight of 422.53 g/mol. Its IUPAC name is tert-butyl 2-[benzyl(phenylmethoxycarbonyl)amino]-6-azabicyclo[3.1.0]hexane-6-carboxylate.
| Compound Name | tert-butyl 2-[benzyl(phenylmethoxycarbonyl)amino]-6-azabicyclo[3.1.0]hexane-6-carboxylate |
|---|---|
| PubChem CID | 167445473 |
| Molecular Formula | C25H30N2O4 |
| Molecular Weight | 422.53 g/mol |
| Exact Mass | 422.22 |
| IUPAC Name | tert-butyl 2-[benzyl(phenylmethoxycarbonyl)amino]-6-azabicyclo[3.1.0]hexane-6-carboxylate |
| SMILES | CC(C)(C)OC(=O)N1C2CCC(N(Cc3ccccc3)C(=O)OCc3ccccc3)C21 |
| InChI | InChI=1S/C25H30N2O4/c1-25(2,3)31-24(29)27-21-15-14-20(22(21)27)26(16-18-10-6-4-7-11-18)23(28)30-17-19-12-8-5-9-13-19/h4-13,20-22H,14-17H2,1-3H3 |
| InChIKey | ZZQYNHFFNLNOFO-UHFFFAOYSA-N |
| XLogP | 4.98 |
| TPSA | 58.85 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 422.53 |
| LogP ≤ 5 | 4.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|